C15H24N2O — CID 12028
2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 12028) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 12028 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 2-(diethylamino)-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | CCN(CC)CC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H24N2O/c1-6-17(7-2)10-14(18)16-15-12(4)8-11(3)9-13(15)5/h8-9H,6-7,10H2,1-5H3,(H,16,18) |
| InChIKey | GOZBHBFUQHMKQB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |