C10H13IO2 — CID 12028094
2-(iodomethyl)-6-methyl-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one (PubChem CID 12028094) has the molecular formula C10H13IO2 and a molecular weight of 292.12 g/mol. Its IUPAC name is 2-(iodomethyl)-6-methyl-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one.
| Compound Name | 2-(iodomethyl)-6-methyl-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
|---|---|
| PubChem CID | 12028094 |
| Molecular Formula | C10H13IO2 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.00 |
| IUPAC Name | 2-(iodomethyl)-6-methyl-3,5,6,7-tetrahydro-2H-1-benzofuran-4-one |
| SMILES | CC1CC(=O)C2=C(C1)OC(CI)C2 |
| InChI | InChI=1S/C10H13IO2/c1-6-2-9(12)8-4-7(5-11)13-10(8)3-6/h6-7H,2-5H2,1H3 |
| InChIKey | CQGFPCIMTSQNEU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|