C13H28O7P2 — CID 12030147
1,5-bis(diethoxyphosphoryl)pentan-3-one (PubChem CID 12030147) has the molecular formula C13H28O7P2 and a molecular weight of 358.31 g/mol. Its IUPAC name is 1,5-bis(diethoxyphosphoryl)pentan-3-one.
| Compound Name | 1,5-bis(diethoxyphosphoryl)pentan-3-one |
|---|---|
| PubChem CID | 12030147 |
| Molecular Formula | C13H28O7P2 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1,5-bis(diethoxyphosphoryl)pentan-3-one |
| SMILES | CCOP(=O)(CCC(=O)CCP(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C13H28O7P2/c1-5-17-21(15,18-6-2)11-9-13(14)10-12-22(16,19-7-3)20-8-4/h5-12H2,1-4H3 |
| InChIKey | YNUSZECLJVIFGU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|