C26H31NO4SSi — CID 12031116
4-methyl-N-[2-[3-(oxan-2-yloxy)prop-1-ynyl]phenyl]-N-(2-trimethylsilylethynyl)benzenesulfonamide (PubChem CID 12031116) has the molecular formula C26H31NO4SSi and a molecular weight of 481.69 g/mol. Its IUPAC name is 4-methyl-N-[2-[3-(oxan-2-yloxy)prop-1-ynyl]phenyl]-N-(2-trimethylsilylethynyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-[2-[3-(oxan-2-yloxy)prop-1-ynyl]phenyl]-N-(2-trimethylsilylethynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 12031116 |
| Molecular Formula | C26H31NO4SSi |
| Molecular Weight | 481.69 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 4-methyl-N-[2-[3-(oxan-2-yloxy)prop-1-ynyl]phenyl]-N-(2-trimethylsilylethynyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C#C[Si](C)(C)C)c2ccccc2C#CCOC2CCCCO2)cc1 |
| InChI | InChI=1S/C26H31NO4SSi/c1-22-14-16-24(17-15-22)32(28,29)27(18-21-33(2,3)4)25-12-6-5-10-23(25)11-9-20-31-26-13-7-8-19-30-26/h5-6,10,12,14-17,26H,7-8,13,19-20H2,1-4H3 |
| InChIKey | HIPBRNWUQINZPO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.69 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|