C29H26N2O4S2 — CID 12031131
4-methyl-2,6-bis-(4-methylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]carbazole (PubChem CID 12031131) has the molecular formula C29H26N2O4S2 and a molecular weight of 530.67 g/mol. Its IUPAC name is 4-methyl-2,6-bis-(4-methylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]carbazole.
| Compound Name | 4-methyl-2,6-bis-(4-methylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]carbazole |
|---|---|
| PubChem CID | 12031131 |
| Molecular Formula | C29H26N2O4S2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 4-methyl-2,6-bis-(4-methylphenyl)sulfonyl-1,3-dihydropyrrolo[3,4-c]carbazole |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3c(C)cc4c(c3C2)c2ccccc2n4S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H26N2O4S2/c1-19-8-12-22(13-9-19)36(32,33)30-17-25-21(3)16-28-29(26(25)18-30)24-6-4-5-7-27(24)31(28)37(34,35)23-14-10-20(2)11-15-23/h4-16H,17-18H2,1-3H3 |
| InChIKey | ZZAFKEBQEYPCNE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |