About (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane
(7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane (PubChem CID 12031185) has the molecular formula C12H22Cl2OSi
and a molecular weight of 281.30 g/mol. Its IUPAC name is (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane.
Molecular Properties
| Compound Name | (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane |
| PubChem CID | 12031185 |
| Molecular Formula | C12H22Cl2OSi |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane |
| SMILES | CC1CCCC2(C)C(Cl)(Cl)C12O[Si](C)(C)C |
| InChI | InChI=1S/C12H22Cl2OSi/c1-9-7-6-8-10(2)11(9,12(10,13)14)15-16(3,4)5/h9H,6-8H2,1-5H3 |
| InChIKey | QEHHGFHWGNTBCE-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane?
The IUPAC name of (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane (CID 12031185) is (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane.
What is the SMILES notation for (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane?
The canonical SMILES for (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane is CC1CCCC2(C)C(Cl)(Cl)C12O[Si](C)(C)C.
What is the InChIKey of (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane?
The InChIKey is QEHHGFHWGNTBCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22Cl2OSi/c1-9-7-6-8-10(2)11(9,12(10,13)14)15-16(3,4)5/h9H,6-8H2,1-5H3.
What are the key properties of (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane?
(7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane has a molecular weight of 281.30 g/mol, XLogP of 4.59, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7,7-dichloro-2,6-dimethyl-1-bicyclo[4.1.0]heptanyl)oxy-trimethylsilane is sourced from PubChem (CID 12031185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).