About 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione
3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione (PubChem CID 12031211) has the molecular formula C8H12N2S
and a molecular weight of 168.26 g/mol. Its IUPAC name is 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione.
Molecular Properties
| Compound Name | 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione |
| PubChem CID | 12031211 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione |
| SMILES | Cc1cc(C)c(CN)c(=S)[nH]1 |
| InChI | InChI=1S/C8H12N2S/c1-5-3-6(2)10-8(11)7(5)4-9/h3H,4,9H2,1-2H3,(H,10,11) |
| InChIKey | HCMMUACNRAEQMR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione?
The IUPAC name of 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione (CID 12031211) is 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione.
What is the SMILES notation for 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione?
The canonical SMILES for 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione is Cc1cc(C)c(CN)c(=S)[nH]1.
What is the InChIKey of 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione?
The InChIKey is HCMMUACNRAEQMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2S/c1-5-3-6(2)10-8(11)7(5)4-9/h3H,4,9H2,1-2H3,(H,10,11).
What are the key properties of 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione?
3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione has a molecular weight of 168.26 g/mol, XLogP of 1.82, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-4,6-dimethyl-1H-pyridine-2-thione is sourced from PubChem (CID 12031211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).