C14H14O4 — CID 12031229
(5E)-3,10-dioxabicyclo[10.4.0]hexadeca-1(16),5,12,14-tetraene-2,11-dione (PubChem CID 12031229) has the molecular formula C14H14O4 and a molecular weight of 246.26 g/mol. Its IUPAC name is (5E)-3,10-dioxabicyclo[10.4.0]hexadeca-1(16),5,12,14-tetraene-2,11-dione.
| Compound Name | (5E)-3,10-dioxabicyclo[10.4.0]hexadeca-1(16),5,12,14-tetraene-2,11-dione |
|---|---|
| PubChem CID | 12031229 |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | (5E)-3,10-dioxabicyclo[10.4.0]hexadeca-1(16),5,12,14-tetraene-2,11-dione |
| SMILES | O=C1OC/C=C/CCCOC(=O)c2ccccc21 |
| InChI | InChI=1S/C14H14O4/c15-13-11-7-3-4-8-12(11)14(16)18-10-6-2-1-5-9-17-13/h1,3-5,7-8H,2,6,9-10H2/b5-1+ |
| InChIKey | OZILEPQXBPVWCF-ORCRQEGFSA-N |
| XLogP | 2.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|