About dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate
dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate (PubChem CID 12031285) has the molecular formula C13H22O5Si
and a molecular weight of 286.40 g/mol. Its IUPAC name is dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate |
| PubChem CID | 12031285 |
| Molecular Formula | C13H22O5Si |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC=C(O[Si](C)(C)C)C[C@H]1C(=O)OC |
| InChI | InChI=1S/C13H22O5Si/c1-16-12(14)10-7-6-9(18-19(3,4)5)8-11(10)13(15)17-2/h6,10-11H,7-8H2,1-5H3/t10-,11-/m1/s1 |
| InChIKey | OPBMKBSOXXDETG-GHMZBOCLSA-N |
| XLogP | 2.09 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate?
The IUPAC name of dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate (CID 12031285) is dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate.
What is the SMILES notation for dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate?
The canonical SMILES for dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate is COC(=O)[C@@H]1CC=C(O[Si](C)(C)C)C[C@H]1C(=O)OC.
What is the InChIKey of dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate?
The InChIKey is OPBMKBSOXXDETG-GHMZBOCLSA-N. The full InChI is InChI=1S/C13H22O5Si/c1-16-12(14)10-7-6-9(18-19(3,4)5)8-11(10)13(15)17-2/h6,10-11H,7-8H2,1-5H3/t10-,11-/m1/s1.
What are the key properties of dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate?
dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate has a molecular weight of 286.40 g/mol, XLogP of 2.09, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (1R,2R)-4-trimethylsilyloxycyclohex-4-ene-1,2-dicarboxylate is sourced from PubChem (CID 12031285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).