About 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole
1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole (PubChem CID 12031296) has the molecular formula C9H11F3N2
and a molecular weight of 204.19 g/mol. Its IUPAC name is 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole.
Molecular Properties
| Compound Name | 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole |
| PubChem CID | 12031296 |
| Molecular Formula | C9H11F3N2 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole |
| SMILES | Cn1nc(C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C9H11F3N2/c1-14-7-5-3-2-4-6(7)8(13-14)9(10,11)12/h2-5H2,1H3 |
| InChIKey | IRLJDHZZLLJTBR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole?
The IUPAC name of 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole (CID 12031296) is 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole.
What is the SMILES notation for 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole?
The canonical SMILES for 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole is Cn1nc(C(F)(F)F)c2c1CCCC2.
What is the InChIKey of 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole?
The InChIKey is IRLJDHZZLLJTBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2/c1-14-7-5-3-2-4-6(7)8(13-14)9(10,11)12/h2-5H2,1H3.
What are the key properties of 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole?
1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole has a molecular weight of 204.19 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazole is sourced from PubChem (CID 12031296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).