C11H11F7N2 — CID 12031300
3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methyl-4,5,6,7-tetrahydroindazole (PubChem CID 12031300) has the molecular formula C11H11F7N2 and a molecular weight of 304.21 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methyl-4,5,6,7-tetrahydroindazole.
| Compound Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 12031300 |
| Molecular Formula | C11H11F7N2 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 3-(1,1,2,2,3,3,3-heptafluoropropyl)-1-methyl-4,5,6,7-tetrahydroindazole |
| SMILES | Cn1nc(C(F)(F)C(F)(F)C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C11H11F7N2/c1-20-7-5-3-2-4-6(7)8(19-20)9(12,13)10(14,15)11(16,17)18/h2-5H2,1H3 |
| InChIKey | QZFNPMGQMCQQKX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|