About (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene
(E)-2,3-diiodo-1-isothiocyanatoprop-1-ene (PubChem CID 12031343) has the molecular formula C4H3I2NS
and a molecular weight of 350.95 g/mol. Its IUPAC name is (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene.
Molecular Properties
| Compound Name | (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene |
| PubChem CID | 12031343 |
| Molecular Formula | C4H3I2NS |
| Molecular Weight | 350.95 g/mol |
| Exact Mass | 350.81 |
| IUPAC Name | (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene |
| SMILES | S=C=N/C=C(/I)CI |
| InChI | InChI=1S/C4H3I2NS/c5-1-4(6)2-7-3-8/h2H,1H2/b4-2+ |
| InChIKey | HKAYOEFTOXIEKW-DUXPYHPUSA-N |
| XLogP | 2.80 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.95 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene?
The IUPAC name of (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene (CID 12031343) is (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene.
What is the SMILES notation for (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene?
The canonical SMILES for (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene is S=C=N/C=C(/I)CI.
What is the InChIKey of (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene?
The InChIKey is HKAYOEFTOXIEKW-DUXPYHPUSA-N. The full InChI is InChI=1S/C4H3I2NS/c5-1-4(6)2-7-3-8/h2H,1H2/b4-2+.
What are the key properties of (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene?
(E)-2,3-diiodo-1-isothiocyanatoprop-1-ene has a molecular weight of 350.95 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-diiodo-1-isothiocyanatoprop-1-ene is sourced from PubChem (CID 12031343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).