About 3,3-diphenylprop-2-enyl 3-oxobutanoate
3,3-diphenylprop-2-enyl 3-oxobutanoate (PubChem CID 12031418) has the molecular formula C19H18O3
and a molecular weight of 294.35 g/mol. Its IUPAC name is 3,3-diphenylprop-2-enyl 3-oxobutanoate.
Molecular Properties
| Compound Name | 3,3-diphenylprop-2-enyl 3-oxobutanoate |
| PubChem CID | 12031418 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 3,3-diphenylprop-2-enyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCC=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H18O3/c1-15(20)14-19(21)22-13-12-18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-12H,13-14H2,1H3 |
| InChIKey | IPXCTIIDQBDTQM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diphenylprop-2-enyl 3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diphenylprop-2-enyl 3-oxobutanoate?
The IUPAC name of 3,3-diphenylprop-2-enyl 3-oxobutanoate (CID 12031418) is 3,3-diphenylprop-2-enyl 3-oxobutanoate.
What is the SMILES notation for 3,3-diphenylprop-2-enyl 3-oxobutanoate?
The canonical SMILES for 3,3-diphenylprop-2-enyl 3-oxobutanoate is CC(=O)CC(=O)OCC=C(c1ccccc1)c1ccccc1.
What is the InChIKey of 3,3-diphenylprop-2-enyl 3-oxobutanoate?
The InChIKey is IPXCTIIDQBDTQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O3/c1-15(20)14-19(21)22-13-12-18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-12H,13-14H2,1H3.
What are the key properties of 3,3-diphenylprop-2-enyl 3-oxobutanoate?
3,3-diphenylprop-2-enyl 3-oxobutanoate has a molecular weight of 294.35 g/mol, XLogP of 3.64, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diphenylprop-2-enyl 3-oxobutanoate is sourced from PubChem (CID 12031418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).