C17H19NO5 — CID 12031655
[(3S)-3-(1,3-dioxoisoindol-2-yl)-5-methyl-2-oxohexyl] acetate (PubChem CID 12031655) has the molecular formula C17H19NO5 and a molecular weight of 317.34 g/mol. Its IUPAC name is [(3S)-3-(1,3-dioxoisoindol-2-yl)-5-methyl-2-oxohexyl] acetate.
| Compound Name | [(3S)-3-(1,3-dioxoisoindol-2-yl)-5-methyl-2-oxohexyl] acetate |
|---|---|
| PubChem CID | 12031655 |
| Molecular Formula | C17H19NO5 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [(3S)-3-(1,3-dioxoisoindol-2-yl)-5-methyl-2-oxohexyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@H](CC(C)C)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H19NO5/c1-10(2)8-14(15(20)9-23-11(3)19)18-16(21)12-6-4-5-7-13(12)17(18)22/h4-7,10,14H,8-9H2,1-3H3/t14-/m0/s1 |
| InChIKey | PXVZCNZLFNCKAX-AWEZNQCLSA-N |
| XLogP | 1.83 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|