About 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one
1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one (PubChem CID 1203198) has the molecular formula C18H27N3O5
and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one.
Molecular Properties
| Compound Name | 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one |
| PubChem CID | 1203198 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one |
| SMILES | COc1cc(CN2CCN(C(=O)CC(C)C)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H27N3O5/c1-13(2)9-18(22)20-7-5-19(6-8-20)12-14-10-16(25-3)17(26-4)11-15(14)21(23)24/h10-11,13H,5-9,12H2,1-4H3 |
| InChIKey | RHXFUYWIBURVLY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 85.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one?
The IUPAC name of 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one (CID 1203198) is 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one.
What is the SMILES notation for 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one?
The canonical SMILES for 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one is COc1cc(CN2CCN(C(=O)CC(C)C)CC2)c([N+](=O)[O-])cc1OC.
What is the InChIKey of 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one?
The InChIKey is RHXFUYWIBURVLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O5/c1-13(2)9-18(22)20-7-5-19(6-8-20)12-14-10-16(25-3)17(26-4)11-15(14)21(23)24/h10-11,13H,5-9,12H2,1-4H3.
What are the key properties of 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one?
1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one has a molecular weight of 365.43 g/mol, XLogP of 2.30, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(4,5-dimethoxy-2-nitrophenyl)methyl]piperazin-1-yl]-3-methylbutan-1-one is sourced from PubChem (CID 1203198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).