C21H15N3O2S — CID 12031997
3-acetyl-8-methyl-5-phenyl-16-thia-5,7-diaza-9-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,7,10,12,14-heptaen-4-olate (PubChem CID 12031997) has the molecular formula C21H15N3O2S and a molecular weight of 373.44 g/mol. Its IUPAC name is 3-acetyl-8-methyl-5-phenyl-16-thia-5,7-diaza-9-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,7,10,12,14-heptaen-4-olate.
| Compound Name | 3-acetyl-8-methyl-5-phenyl-16-thia-5,7-diaza-9-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,7,10,12,14-heptaen-4-olate |
|---|---|
| PubChem CID | 12031997 |
| Molecular Formula | C21H15N3O2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | 3-acetyl-8-methyl-5-phenyl-16-thia-5,7-diaza-9-azoniatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,7,10,12,14-heptaen-4-olate |
| SMILES | CC(=O)c1c([O-])n(-c2ccccc2)c2nc(C)[n+]3c4ccccc4sc3c12 |
| InChI | InChI=1S/C21H15N3O2S/c1-12(25)17-18-19(24(20(17)26)14-8-4-3-5-9-14)22-13(2)23-15-10-6-7-11-16(15)27-21(18)23/h3-11H,1-2H3 |
| InChIKey | PTTHZHPYVZTAKU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|