C17H19N3S2 — CID 1203210
4-N,4-N-diethyl-1-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzene-1,4-diamine (PubChem CID 1203210) has the molecular formula C17H19N3S2 and a molecular weight of 329.49 g/mol. Its IUPAC name is 4-N,4-N-diethyl-1-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzene-1,4-diamine.
| Compound Name | 4-N,4-N-diethyl-1-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 1203210 |
| Molecular Formula | C17H19N3S2 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-N,4-N-diethyl-1-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nc(-c3cccs3)cs2)cc1 |
| InChI | InChI=1S/C17H19N3S2/c1-3-20(4-2)14-9-7-13(8-10-14)18-17-19-15(12-22-17)16-6-5-11-21-16/h5-12H,3-4H2,1-2H3,(H,18,19) |
| InChIKey | CXSQTGGPDGNRKF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|