C15H18O4 — CID 12032126
4-[(E)-2-methoxyhept-2-en-3-yl]furo[2,3-c]pyran-5-one (PubChem CID 12032126) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is 4-[(E)-2-methoxyhept-2-en-3-yl]furo[2,3-c]pyran-5-one.
| Compound Name | 4-[(E)-2-methoxyhept-2-en-3-yl]furo[2,3-c]pyran-5-one |
|---|---|
| PubChem CID | 12032126 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-[(E)-2-methoxyhept-2-en-3-yl]furo[2,3-c]pyran-5-one |
| SMILES | CCCC/C(=C(/C)OC)c1c(=O)occ2occc12 |
| InChI | InChI=1S/C15H18O4/c1-4-5-6-11(10(2)17-3)14-12-7-8-18-13(12)9-19-15(14)16/h7-9H,4-6H2,1-3H3/b11-10+ |
| InChIKey | FQRKJNXEZJUPEB-ZHACJKMWSA-N |
| XLogP | 3.95 |
| TPSA | 52.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|