About 3-iodoquinolin-8-amine
3-iodoquinolin-8-amine (PubChem CID 12032368) has the molecular formula C9H7IN2
and a molecular weight of 270.07 g/mol. Its IUPAC name is 3-iodoquinolin-8-amine.
Molecular Properties
| Compound Name | 3-iodoquinolin-8-amine |
| PubChem CID | 12032368 |
| Molecular Formula | C9H7IN2 |
| Molecular Weight | 270.07 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | 3-iodoquinolin-8-amine |
| SMILES | Nc1cccc2cc(I)cnc12 |
| InChI | InChI=1S/C9H7IN2/c10-7-4-6-2-1-3-8(11)9(6)12-5-7/h1-5H,11H2 |
| InChIKey | DXMKBPNVNXDMHP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.07 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodoquinolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodoquinolin-8-amine?
The IUPAC name of 3-iodoquinolin-8-amine (CID 12032368) is 3-iodoquinolin-8-amine.
What is the SMILES notation for 3-iodoquinolin-8-amine?
The canonical SMILES for 3-iodoquinolin-8-amine is Nc1cccc2cc(I)cnc12.
What is the InChIKey of 3-iodoquinolin-8-amine?
The InChIKey is DXMKBPNVNXDMHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7IN2/c10-7-4-6-2-1-3-8(11)9(6)12-5-7/h1-5H,11H2.
What are the key properties of 3-iodoquinolin-8-amine?
3-iodoquinolin-8-amine has a molecular weight of 270.07 g/mol, XLogP of 2.42, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodoquinolin-8-amine is sourced from PubChem (CID 12032368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).