About decane-2,5,8-trione
decane-2,5,8-trione (PubChem CID 12032450) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is decane-2,5,8-trione.
Molecular Properties
| Compound Name | decane-2,5,8-trione |
| PubChem CID | 12032450 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | decane-2,5,8-trione |
| SMILES | CCC(=O)CCC(=O)CCC(C)=O |
| InChI | InChI=1S/C10H16O3/c1-3-9(12)6-7-10(13)5-4-8(2)11/h3-7H2,1-2H3 |
| InChIKey | XIUPHVITAFTFDQ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze decane-2,5,8-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decane-2,5,8-trione?
The IUPAC name of decane-2,5,8-trione (CID 12032450) is decane-2,5,8-trione.
What is the SMILES notation for decane-2,5,8-trione?
The canonical SMILES for decane-2,5,8-trione is CCC(=O)CCC(=O)CCC(C)=O.
What is the InChIKey of decane-2,5,8-trione?
The InChIKey is XIUPHVITAFTFDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O3/c1-3-9(12)6-7-10(13)5-4-8(2)11/h3-7H2,1-2H3.
What are the key properties of decane-2,5,8-trione?
decane-2,5,8-trione has a molecular weight of 184.23 g/mol, XLogP of 1.68, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decane-2,5,8-trione is sourced from PubChem (CID 12032450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).