C16H22F3NO — CID 12032480
N-but-3-enyl-N-(3-ethenylocta-1,7-dien-3-yl)-2,2,2-trifluoroacetamide (PubChem CID 12032480) has the molecular formula C16H22F3NO and a molecular weight of 301.35 g/mol. Its IUPAC name is N-but-3-enyl-N-(3-ethenylocta-1,7-dien-3-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-but-3-enyl-N-(3-ethenylocta-1,7-dien-3-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 12032480 |
| Molecular Formula | C16H22F3NO |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | N-but-3-enyl-N-(3-ethenylocta-1,7-dien-3-yl)-2,2,2-trifluoroacetamide |
| SMILES | C=CCCCC(C=C)(C=C)N(CCC=C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H22F3NO/c1-5-9-11-12-15(7-3,8-4)20(13-10-6-2)14(21)16(17,18)19/h5-8H,1-4,9-13H2 |
| InChIKey | HPDBOJHPYHRARK-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|