C12H14F3NO — CID 12032481
1-(1-azaspiro[5.5]undeca-4,10-dien-1-yl)-2,2,2-trifluoroethanone (PubChem CID 12032481) has the molecular formula C12H14F3NO and a molecular weight of 245.24 g/mol. Its IUPAC name is 1-(1-azaspiro[5.5]undeca-4,10-dien-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(1-azaspiro[5.5]undeca-4,10-dien-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 12032481 |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-(1-azaspiro[5.5]undeca-4,10-dien-1-yl)-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CCC=CC12C=CCCC2)C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO/c13-12(14,15)10(17)16-9-5-4-8-11(16)6-2-1-3-7-11/h2,4,6,8H,1,3,5,7,9H2 |
| InChIKey | BZCQKZGUYXDMLD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.24 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|