C22H14N4O4 — CID 12033273
(4R,5R)-2-amino-4,5-bis(1,3-benzodioxol-5-yl)cyclopent-2-ene-1,1,3-tricarbonitrile (PubChem CID 12033273) has the molecular formula C22H14N4O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is (4R,5R)-2-amino-4,5-bis(1,3-benzodioxol-5-yl)cyclopent-2-ene-1,1,3-tricarbonitrile.
| Compound Name | (4R,5R)-2-amino-4,5-bis(1,3-benzodioxol-5-yl)cyclopent-2-ene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 12033273 |
| Molecular Formula | C22H14N4O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | (4R,5R)-2-amino-4,5-bis(1,3-benzodioxol-5-yl)cyclopent-2-ene-1,1,3-tricarbonitrile |
| SMILES | N#CC1=C(N)C(C#N)(C#N)[C@@H](c2ccc3c(c2)OCO3)[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H14N4O4/c23-7-14-19(12-1-3-15-17(5-12)29-10-27-15)20(22(8-24,9-25)21(14)26)13-2-4-16-18(6-13)30-11-28-16/h1-6,19-20H,10-11,26H2/t19-,20+/m1/s1 |
| InChIKey | YEAHYJGZXIJYIS-UXHICEINSA-N |
| XLogP | 2.79 |
| TPSA | 134.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_ene_amine_A(56)', 'substructure': 'N/A'} |
|---|