C45H48O6 — CID 12033456
triethyl 2,5,8-tribenzyl-1,3,4,6,7,9-hexahydrocyclopenta[e]-as-indacene-2,5,8-tricarboxylate (PubChem CID 12033456) has the molecular formula C45H48O6 and a molecular weight of 684.87 g/mol. Its IUPAC name is triethyl 2,5,8-tribenzyl-1,3,4,6,7,9-hexahydrocyclopenta[e]-as-indacene-2,5,8-tricarboxylate.
| Compound Name | triethyl 2,5,8-tribenzyl-1,3,4,6,7,9-hexahydrocyclopenta[e]-as-indacene-2,5,8-tricarboxylate |
|---|---|
| PubChem CID | 12033456 |
| Molecular Formula | C45H48O6 |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.35 |
| IUPAC Name | triethyl 2,5,8-tribenzyl-1,3,4,6,7,9-hexahydrocyclopenta[e]-as-indacene-2,5,8-tricarboxylate |
| SMILES | CCOC(=O)C1(Cc2ccccc2)Cc2c3c(c4c(c2C1)CC(Cc1ccccc1)(C(=O)OCC)C4)CC(Cc1ccccc1)(C(=O)OCC)C3 |
| InChI | InChI=1S/C45H48O6/c1-4-49-40(46)43(22-31-16-10-7-11-17-31)25-34-35(26-43)37-28-45(42(48)51-6-3,24-33-20-14-9-15-21-33)30-39(37)38-29-44(27-36(34)38,41(47)50-5-2)23-32-18-12-8-13-19-32/h7-21H,4-6,22-30H2,1-3H3 |
| InChIKey | OGUNLAGGFCCVJQ-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|