C14H23NO2 — CID 12033481
(1R,5S)-3-acetyl-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-7-carbaldehyde (PubChem CID 12033481) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (1R,5S)-3-acetyl-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-7-carbaldehyde.
| Compound Name | (1R,5S)-3-acetyl-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-7-carbaldehyde |
|---|---|
| PubChem CID | 12033481 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (1R,5S)-3-acetyl-1,5,7-trimethyl-3-azabicyclo[3.3.1]nonane-7-carbaldehyde |
| SMILES | CC(=O)N1C[C@@]2(C)CC(C)(C=O)C[C@@](C)(C1)C2 |
| InChI | InChI=1S/C14H23NO2/c1-11(17)15-8-12(2)5-13(3,9-15)7-14(4,6-12)10-16/h10H,5-9H2,1-4H3/t12-,13+,14? |
| InChIKey | GDYOFMFPTIMBAP-PBWFPOADSA-N |
| XLogP | 2.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|