About (E)-2,6-dimethyloct-2-ene-1,8-diol
(E)-2,6-dimethyloct-2-ene-1,8-diol (PubChem CID 12033666) has the molecular formula C10H20O2
and a molecular weight of 172.27 g/mol. Its IUPAC name is (E)-2,6-dimethyloct-2-ene-1,8-diol.
Molecular Properties
| Compound Name | (E)-2,6-dimethyloct-2-ene-1,8-diol |
| PubChem CID | 12033666 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (E)-2,6-dimethyloct-2-ene-1,8-diol |
| SMILES | C/C(=C\CCC(C)CCO)CO |
| InChI | InChI=1S/C10H20O2/c1-9(6-7-11)4-3-5-10(2)8-12/h5,9,11-12H,3-4,6-8H2,1-2H3/b10-5+ |
| InChIKey | FZBXHGXRUNRMTQ-BJMVGYQFSA-N |
| XLogP | 1.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,6-dimethyloct-2-ene-1,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,6-dimethyloct-2-ene-1,8-diol?
The IUPAC name of (E)-2,6-dimethyloct-2-ene-1,8-diol (CID 12033666) is (E)-2,6-dimethyloct-2-ene-1,8-diol.
What is the SMILES notation for (E)-2,6-dimethyloct-2-ene-1,8-diol?
The canonical SMILES for (E)-2,6-dimethyloct-2-ene-1,8-diol is C/C(=C\CCC(C)CCO)CO.
What is the InChIKey of (E)-2,6-dimethyloct-2-ene-1,8-diol?
The InChIKey is FZBXHGXRUNRMTQ-BJMVGYQFSA-N. The full InChI is InChI=1S/C10H20O2/c1-9(6-7-11)4-3-5-10(2)8-12/h5,9,11-12H,3-4,6-8H2,1-2H3/b10-5+.
What are the key properties of (E)-2,6-dimethyloct-2-ene-1,8-diol?
(E)-2,6-dimethyloct-2-ene-1,8-diol has a molecular weight of 172.27 g/mol, XLogP of 1.72, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,6-dimethyloct-2-ene-1,8-diol is sourced from PubChem (CID 12033666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).