C9H15N3O2 — CID 12034251
1,3-diethyl-5-(methylamino)pyrimidine-2,4-dione (PubChem CID 12034251) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1,3-diethyl-5-(methylamino)pyrimidine-2,4-dione.
| Compound Name | 1,3-diethyl-5-(methylamino)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12034251 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1,3-diethyl-5-(methylamino)pyrimidine-2,4-dione |
| SMILES | CCn1cc(NC)c(=O)n(CC)c1=O |
| InChI | InChI=1S/C9H15N3O2/c1-4-11-6-7(10-3)8(13)12(5-2)9(11)14/h6,10H,4-5H2,1-3H3 |
| InChIKey | VKDLWDKOQLYRAT-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 56.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |