C12H10N2O3S — CID 12034659
N-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-yl)acetamide (PubChem CID 12034659) has the molecular formula C12H10N2O3S and a molecular weight of 262.29 g/mol. Its IUPAC name is N-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-yl)acetamide.
| Compound Name | N-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-yl)acetamide |
|---|---|
| PubChem CID | 12034659 |
| Molecular Formula | C12H10N2O3S |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | N-(2,2-dioxo-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),4(12),5,7,9-pentaen-7-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c3c(cccc13)S(=O)(=O)N2 |
| InChI | InChI=1S/C12H10N2O3S/c1-7(15)13-9-5-6-10-12-8(9)3-2-4-11(12)18(16,17)14-10/h2-6,14H,1H3,(H,13,15) |
| InChIKey | AORFYPDMEMDJHU-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |