C11H12ClNO — CID 12034714
2-(4-chlorophenyl)-4-ethyl-4,5-dihydro-1,3-oxazole (PubChem CID 12034714) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-ethyl-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(4-chlorophenyl)-4-ethyl-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 12034714 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-(4-chlorophenyl)-4-ethyl-4,5-dihydro-1,3-oxazole |
| SMILES | CCC1COC(c2ccc(Cl)cc2)=N1 |
| InChI | InChI=1S/C11H12ClNO/c1-2-10-7-14-11(13-10)8-3-5-9(12)6-4-8/h3-6,10H,2,7H2,1H3 |
| InChIKey | IEMFMONVMSCOFG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |