C22H43NO4Si — CID 12034964
tert-butyl N-[(1S,2R,6S)-3-butyl-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxycyclohept-3-en-1-yl]carbamate (PubChem CID 12034964) has the molecular formula C22H43NO4Si and a molecular weight of 413.68 g/mol. Its IUPAC name is tert-butyl N-[(1S,2R,6S)-3-butyl-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxycyclohept-3-en-1-yl]carbamate.
| Compound Name | tert-butyl N-[(1S,2R,6S)-3-butyl-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxycyclohept-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 12034964 |
| Molecular Formula | C22H43NO4Si |
| Molecular Weight | 413.68 g/mol |
| Exact Mass | 413.30 |
| IUPAC Name | tert-butyl N-[(1S,2R,6S)-3-butyl-6-[tert-butyl(dimethyl)silyl]oxy-2-hydroxycyclohept-3-en-1-yl]carbamate |
| SMILES | CCCCC1=CC[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](NC(=O)OC(C)(C)C)[C@@H]1O |
| InChI | InChI=1S/C22H43NO4Si/c1-10-11-12-16-13-14-17(27-28(8,9)22(5,6)7)15-18(19(16)24)23-20(25)26-21(2,3)4/h13,17-19,24H,10-12,14-15H2,1-9H3,(H,23,25)/t17-,18-,19+/m0/s1 |
| InChIKey | WEXSZGLMGGRQOZ-GBESFXJTSA-N |
| XLogP | 5.54 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.68 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|