C20H19N5O7 — CID 12035126
5-[3-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-oxo-1H-indol-3-yl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 12035126) has the molecular formula C20H19N5O7 and a molecular weight of 441.40 g/mol. Its IUPAC name is 5-[3-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-oxo-1H-indol-3-yl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[3-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-oxo-1H-indol-3-yl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12035126 |
| Molecular Formula | C20H19N5O7 |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 5-[3-(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-yl)-2-oxo-1H-indol-3-yl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(C2(C3C(=O)N(C)C(=O)N(C)C3=O)C(=O)Nc3ccccc32)C(=O)N(C)C1=O |
| InChI | InChI=1S/C20H19N5O7/c1-22-13(26)11(14(27)23(2)18(22)31)20(9-7-5-6-8-10(9)21-17(20)30)12-15(28)24(3)19(32)25(4)16(12)29/h5-8,11-12H,1-4H3,(H,21,30) |
| InChIKey | LYBIHXRQQJCTLA-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|