C18H23F3N2O2 — CID 12035432
N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-N-[(2R)-1,1,1-trifluoropent-4-en-2-yl]benzamide (PubChem CID 12035432) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-N-[(2R)-1,1,1-trifluoropent-4-en-2-yl]benzamide.
| Compound Name | N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-N-[(2R)-1,1,1-trifluoropent-4-en-2-yl]benzamide |
|---|---|
| PubChem CID | 12035432 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-N-[(2R)-1,1,1-trifluoropent-4-en-2-yl]benzamide |
| SMILES | C=CC[C@@H](N(C(=O)c1ccccc1)N1CCC[C@H]1COC)C(F)(F)F |
| InChI | InChI=1S/C18H23F3N2O2/c1-3-8-16(18(19,20)21)23(17(24)14-9-5-4-6-10-14)22-12-7-11-15(22)13-25-2/h3-6,9-10,15-16H,1,7-8,11-13H2,2H3/t15-,16+/m0/s1 |
| InChIKey | UOYZZQXTPHMELW-JKSUJKDBSA-N |
| XLogP | 3.66 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|