C10H10F3NO — CID 12035528
4-[5-(trifluoromethyl)-2-pyridinyl]butan-2-one (PubChem CID 12035528) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is 4-[5-(trifluoromethyl)-2-pyridinyl]butan-2-one.
| Compound Name | 4-[5-(trifluoromethyl)-2-pyridinyl]butan-2-one |
|---|---|
| PubChem CID | 12035528 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 4-[5-(trifluoromethyl)-2-pyridinyl]butan-2-one |
| SMILES | CC(=O)CCc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C10H10F3NO/c1-7(15)2-4-9-5-3-8(6-14-9)10(11,12)13/h3,5-6H,2,4H2,1H3 |
| InChIKey | DMSNRVFRUDJSBN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |