C16H13N3O4 — CID 12035822
9-hydroxy-15-methoxy-14-methyl-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,11,15,17-heptaen-13-one (PubChem CID 12035822) has the molecular formula C16H13N3O4 and a molecular weight of 311.30 g/mol. Its IUPAC name is 9-hydroxy-15-methoxy-14-methyl-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,11,15,17-heptaen-13-one.
| Compound Name | 9-hydroxy-15-methoxy-14-methyl-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,11,15,17-heptaen-13-one |
|---|---|
| PubChem CID | 12035822 |
| Molecular Formula | C16H13N3O4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 9-hydroxy-15-methoxy-14-methyl-8-oxa-14,16,18-triazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),2,4,6,11,15,17-heptaen-13-one |
| SMILES | COc1nc2nc3c(cc2c(=O)n1C)C(O)Oc1ccccc1-3 |
| InChI | InChI=1S/C16H13N3O4/c1-19-14(20)10-7-9-12(17-13(10)18-16(19)22-2)8-5-3-4-6-11(8)23-15(9)21/h3-7,15,21H,1-2H3 |
| InChIKey | LNEKUMDBOUIBAK-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |