About 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole
2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole (PubChem CID 12035825) has the molecular formula C14H12N4O
and a molecular weight of 252.28 g/mol. Its IUPAC name is 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole |
| PubChem CID | 12035825 |
| Molecular Formula | C14H12N4O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole |
| SMILES | Cn1cnc2cc3c(cc21)nc(-c1ccco1)n3C |
| InChI | InChI=1S/C14H12N4O/c1-17-8-15-9-6-12-10(7-11(9)17)16-14(18(12)2)13-4-3-5-19-13/h3-8H,1-2H3 |
| InChIKey | GKUMFDKJNSVHPR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole?
The IUPAC name of 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole (CID 12035825) is 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole.
What is the SMILES notation for 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole?
The canonical SMILES for 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole is Cn1cnc2cc3c(cc21)nc(-c1ccco1)n3C.
What is the InChIKey of 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole?
The InChIKey is GKUMFDKJNSVHPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O/c1-17-8-15-9-6-12-10(7-11(9)17)16-14(18(12)2)13-4-3-5-19-13/h3-8H,1-2H3.
What are the key properties of 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole?
2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole has a molecular weight of 252.28 g/mol, XLogP of 2.72, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-3,7-dimethylimidazo[4,5-f]benzimidazole is sourced from PubChem (CID 12035825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).