About 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine
2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine (PubChem CID 1203597) has the molecular formula C20H33NO
and a molecular weight of 303.49 g/mol. Its IUPAC name is 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine.
Molecular Properties
| Compound Name | 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine |
| PubChem CID | 1203597 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine |
| SMILES | CCN(CC)CCO[C@@H](c1ccccc1C)C1CCCCC1 |
| InChI | InChI=1S/C20H33NO/c1-4-21(5-2)15-16-22-20(18-12-7-6-8-13-18)19-14-10-9-11-17(19)3/h9-11,14,18,20H,4-8,12-13,15-16H2,1-3H3/t20-/m1/s1 |
| InChIKey | OVWYRYFAKYWFLR-HXUWFJFHSA-N |
| XLogP | 4.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine?
The IUPAC name of 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine (CID 1203597) is 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine.
What is the SMILES notation for 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine?
The canonical SMILES for 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine is CCN(CC)CCO[C@@H](c1ccccc1C)C1CCCCC1.
What is the InChIKey of 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine?
The InChIKey is OVWYRYFAKYWFLR-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H33NO/c1-4-21(5-2)15-16-22-20(18-12-7-6-8-13-18)19-14-10-9-11-17(19)3/h9-11,14,18,20H,4-8,12-13,15-16H2,1-3H3/t20-/m1/s1.
What are the key properties of 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine?
2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine has a molecular weight of 303.49 g/mol, XLogP of 4.97, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(R)-cyclohexyl-(2-methylphenyl)methoxy]-N,N-diethylethanamine is sourced from PubChem (CID 1203597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).