About 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid
1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid (PubChem CID 12036249) has the molecular formula C20H21FN2O3
and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid |
| PubChem CID | 12036249 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CC1=CCC(C(=O)O)(C(=O)n2nc(C)cc2C)C(c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C20H21FN2O3/c1-12-8-9-20(19(25)26,18(24)23-14(3)11-13(2)22-23)17(10-12)15-4-6-16(21)7-5-15/h4-8,11,17H,9-10H2,1-3H3,(H,25,26) |
| InChIKey | HTTVEWWVLGGQFB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid?
The IUPAC name of 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid (CID 12036249) is 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid.
What is the SMILES notation for 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid?
The canonical SMILES for 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid is CC1=CCC(C(=O)O)(C(=O)n2nc(C)cc2C)C(c2ccc(F)cc2)C1.
What is the InChIKey of 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid?
The InChIKey is HTTVEWWVLGGQFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN2O3/c1-12-8-9-20(19(25)26,18(24)23-14(3)11-13(2)22-23)17(10-12)15-4-6-16(21)7-5-15/h4-8,11,17H,9-10H2,1-3H3,(H,25,26).
What are the key properties of 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid?
1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid has a molecular weight of 356.40 g/mol, XLogP of 3.87, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethylpyrazole-1-carbonyl)-6-(4-fluorophenyl)-4-methylcyclohex-3-ene-1-carboxylic acid is sourced from PubChem (CID 12036249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).