About 1-(methoxymethyl)-4,5-diphenylimidazole
1-(methoxymethyl)-4,5-diphenylimidazole (PubChem CID 1203650) has the molecular formula C17H16N2O
and a molecular weight of 264.33 g/mol. Its IUPAC name is 1-(methoxymethyl)-4,5-diphenylimidazole.
Molecular Properties
| Compound Name | 1-(methoxymethyl)-4,5-diphenylimidazole |
| PubChem CID | 1203650 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 1-(methoxymethyl)-4,5-diphenylimidazole |
| SMILES | COCn1cnc(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C17H16N2O/c1-20-13-19-12-18-16(14-8-4-2-5-9-14)17(19)15-10-6-3-7-11-15/h2-12H,13H2,1H3 |
| InChIKey | YQENIAMSXXYXDH-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(methoxymethyl)-4,5-diphenylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(methoxymethyl)-4,5-diphenylimidazole?
The IUPAC name of 1-(methoxymethyl)-4,5-diphenylimidazole (CID 1203650) is 1-(methoxymethyl)-4,5-diphenylimidazole.
What is the SMILES notation for 1-(methoxymethyl)-4,5-diphenylimidazole?
The canonical SMILES for 1-(methoxymethyl)-4,5-diphenylimidazole is COCn1cnc(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 1-(methoxymethyl)-4,5-diphenylimidazole?
The InChIKey is YQENIAMSXXYXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O/c1-20-13-19-12-18-16(14-8-4-2-5-9-14)17(19)15-10-6-3-7-11-15/h2-12H,13H2,1H3.
What are the key properties of 1-(methoxymethyl)-4,5-diphenylimidazole?
1-(methoxymethyl)-4,5-diphenylimidazole has a molecular weight of 264.33 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(methoxymethyl)-4,5-diphenylimidazole is sourced from PubChem (CID 1203650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).