C32H16O4 — CID 12036891
5,10,15,20-tetraethynyl-5,10,15,20-tetramethoxycycloicosa-1,3,6,8,11,13,16,18-octayne (PubChem CID 12036891) has the molecular formula C32H16O4 and a molecular weight of 464.48 g/mol. Its IUPAC name is 5,10,15,20-tetraethynyl-5,10,15,20-tetramethoxycycloicosa-1,3,6,8,11,13,16,18-octayne.
| Compound Name | 5,10,15,20-tetraethynyl-5,10,15,20-tetramethoxycycloicosa-1,3,6,8,11,13,16,18-octayne |
|---|---|
| PubChem CID | 12036891 |
| Molecular Formula | C32H16O4 |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 5,10,15,20-tetraethynyl-5,10,15,20-tetramethoxycycloicosa-1,3,6,8,11,13,16,18-octayne |
| SMILES | C#CC1(OC)C#CC#CC(C#C)(OC)C#CC#CC(C#C)(OC)C#CC#CC(C#C)(OC)C#CC#C1 |
| InChI | InChI=1S/C32H16O4/c1-9-29(33-5)21-13-15-23-30(10-2,34-6)25-17-19-27-32(12-4,36-8)28-20-18-26-31(11-3,35-7)24-16-14-22-29/h1-4H,5-8H3 |
| InChIKey | KBAADEXLCTXREQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|