C10Cl3F15N2O — CID 12036959
3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-5-(trichloromethyl)-1,2,4-oxadiazole (PubChem CID 12036959) has the molecular formula C10Cl3F15N2O and a molecular weight of 555.45 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-5-(trichloromethyl)-1,2,4-oxadiazole.
| Compound Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-5-(trichloromethyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 12036959 |
| Molecular Formula | C10Cl3F15N2O |
| Molecular Weight | 555.45 g/mol |
| Exact Mass | 553.88 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-5-(trichloromethyl)-1,2,4-oxadiazole |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1noc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C10Cl3F15N2O/c11-4(12,13)2-29-1(30-31-2)3(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)10(26,27)28 |
| InChIKey | ZXHDOBBHADENDH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.45 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|