C10H6F2O — CID 12037073
4,5-difluoro-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (PubChem CID 12037073) has the molecular formula C10H6F2O and a molecular weight of 180.15 g/mol. Its IUPAC name is 4,5-difluoro-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene.
| Compound Name | 4,5-difluoro-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 12037073 |
| Molecular Formula | C10H6F2O |
| Molecular Weight | 180.15 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 4,5-difluoro-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| SMILES | Fc1cc2c(cc1F)C1C=CC2O1 |
| InChI | InChI=1S/C10H6F2O/c11-7-3-5-6(4-8(7)12)10-2-1-9(5)13-10/h1-4,9-10H |
| InChIKey | ZPPOWALWUZIHJZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.15 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|