C18H19ClN2O3 — CID 1203722
5-chloro-N-[4-(2,2-dimethylpropanoylamino)phenyl]-2-hydroxybenzamide (PubChem CID 1203722) has the molecular formula C18H19ClN2O3 and a molecular weight of 346.81 g/mol. Its IUPAC name is 5-chloro-N-[4-(2,2-dimethylpropanoylamino)phenyl]-2-hydroxybenzamide.
| Compound Name | 5-chloro-N-[4-(2,2-dimethylpropanoylamino)phenyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 1203722 |
| Molecular Formula | C18H19ClN2O3 |
| Molecular Weight | 346.81 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 5-chloro-N-[4-(2,2-dimethylpropanoylamino)phenyl]-2-hydroxybenzamide |
| SMILES | CC(C)(C)C(=O)Nc1ccc(NC(=O)c2cc(Cl)ccc2O)cc1 |
| InChI | InChI=1S/C18H19ClN2O3/c1-18(2,3)17(24)21-13-7-5-12(6-8-13)20-16(23)14-10-11(19)4-9-15(14)22/h4-10,22H,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | AVZFIBYJGWVKIB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |