C15H30O2Si — CID 12037363
(2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-6-methylcyclohexan-1-one (PubChem CID 12037363) has the molecular formula C15H30O2Si and a molecular weight of 270.49 g/mol. Its IUPAC name is (2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-6-methylcyclohexan-1-one.
| Compound Name | (2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-6-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 12037363 |
| Molecular Formula | C15H30O2Si |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (2R,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-2-ethyl-6-methylcyclohexan-1-one |
| SMILES | CC[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](C)C1=O |
| InChI | InChI=1S/C15H30O2Si/c1-8-12-10-13(9-11(2)14(12)16)17-18(6,7)15(3,4)5/h11-13H,8-10H2,1-7H3/t11-,12+,13+/m0/s1 |
| InChIKey | RNKYGPVQNXXGRX-YNEHKIRRSA-N |
| XLogP | 4.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|