About (3R,4R)-3,4-dimethylcyclohexene
(3R,4R)-3,4-dimethylcyclohexene (PubChem CID 12037452) has the molecular formula C8H14
and a molecular weight of 110.20 g/mol. Its IUPAC name is (3R,4R)-3,4-dimethylcyclohexene.
Molecular Properties
| Compound Name | (3R,4R)-3,4-dimethylcyclohexene |
| PubChem CID | 12037452 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | (3R,4R)-3,4-dimethylcyclohexene |
| SMILES | C[C@@H]1CCC=C[C@@H]1C |
| InChI | InChI=1S/C8H14/c1-7-5-3-4-6-8(7)2/h3,5,7-8H,4,6H2,1-2H3/t7-,8+/m0/s1 |
| InChIKey | KKDZMSWHDHBHEU-JGVFFNPUSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,4R)-3,4-dimethylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-3,4-dimethylcyclohexene?
The IUPAC name of (3R,4R)-3,4-dimethylcyclohexene (CID 12037452) is (3R,4R)-3,4-dimethylcyclohexene.
What is the SMILES notation for (3R,4R)-3,4-dimethylcyclohexene?
The canonical SMILES for (3R,4R)-3,4-dimethylcyclohexene is C[C@@H]1CCC=C[C@@H]1C.
What is the InChIKey of (3R,4R)-3,4-dimethylcyclohexene?
The InChIKey is KKDZMSWHDHBHEU-JGVFFNPUSA-N. The full InChI is InChI=1S/C8H14/c1-7-5-3-4-6-8(7)2/h3,5,7-8H,4,6H2,1-2H3/t7-,8+/m0/s1.
What are the key properties of (3R,4R)-3,4-dimethylcyclohexene?
(3R,4R)-3,4-dimethylcyclohexene has a molecular weight of 110.20 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-3,4-dimethylcyclohexene is sourced from PubChem (CID 12037452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).