About 1,4-bis(benzenesulfonyl)piperazine-2,5-dione
1,4-bis(benzenesulfonyl)piperazine-2,5-dione (PubChem CID 12037467) has the molecular formula C16H14N2O6S2
and a molecular weight of 394.43 g/mol. Its IUPAC name is 1,4-bis(benzenesulfonyl)piperazine-2,5-dione.
Molecular Properties
| Compound Name | 1,4-bis(benzenesulfonyl)piperazine-2,5-dione |
| PubChem CID | 12037467 |
| Molecular Formula | C16H14N2O6S2 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 1,4-bis(benzenesulfonyl)piperazine-2,5-dione |
| SMILES | O=C1CN(S(=O)(=O)c2ccccc2)C(=O)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O6S2/c19-15-12-18(26(23,24)14-9-5-2-6-10-14)16(20)11-17(15)25(21,22)13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | NHASEHCTEAENPG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,4-bis(benzenesulfonyl)piperazine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(benzenesulfonyl)piperazine-2,5-dione?
The IUPAC name of 1,4-bis(benzenesulfonyl)piperazine-2,5-dione (CID 12037467) is 1,4-bis(benzenesulfonyl)piperazine-2,5-dione.
What is the SMILES notation for 1,4-bis(benzenesulfonyl)piperazine-2,5-dione?
The canonical SMILES for 1,4-bis(benzenesulfonyl)piperazine-2,5-dione is O=C1CN(S(=O)(=O)c2ccccc2)C(=O)CN1S(=O)(=O)c1ccccc1.
What is the InChIKey of 1,4-bis(benzenesulfonyl)piperazine-2,5-dione?
The InChIKey is NHASEHCTEAENPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O6S2/c19-15-12-18(26(23,24)14-9-5-2-6-10-14)16(20)11-17(15)25(21,22)13-7-3-1-4-8-13/h1-10H,11-12H2.
What are the key properties of 1,4-bis(benzenesulfonyl)piperazine-2,5-dione?
1,4-bis(benzenesulfonyl)piperazine-2,5-dione has a molecular weight of 394.43 g/mol, XLogP of 0.44, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(benzenesulfonyl)piperazine-2,5-dione is sourced from PubChem (CID 12037467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).