About O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate
O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate (PubChem CID 12037792) has the molecular formula C8H13NOS
and a molecular weight of 171.27 g/mol. Its IUPAC name is O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate.
Molecular Properties
| Compound Name | O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate |
| PubChem CID | 12037792 |
| Molecular Formula | C8H13NOS |
| Molecular Weight | 171.27 g/mol |
| Exact Mass | 171.07 |
| IUPAC Name | O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate |
| SMILES | CNC(=S)O[C@@H]1C=CCCC1 |
| InChI | InChI=1S/C8H13NOS/c1-9-8(11)10-7-5-3-2-4-6-7/h3,5,7H,2,4,6H2,1H3,(H,9,11)/t7-/m1/s1 |
| InChIKey | AZBQTGXYOMRZKK-SSDOTTSWSA-N |
| XLogP | 1.62 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate?
The IUPAC name of O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate (CID 12037792) is O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate.
What is the SMILES notation for O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate?
The canonical SMILES for O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate is CNC(=S)O[C@@H]1C=CCCC1.
What is the InChIKey of O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate?
The InChIKey is AZBQTGXYOMRZKK-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H13NOS/c1-9-8(11)10-7-5-3-2-4-6-7/h3,5,7H,2,4,6H2,1H3,(H,9,11)/t7-/m1/s1.
What are the key properties of O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate?
O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate has a molecular weight of 171.27 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for O-[(1S)-cyclohex-2-en-1-yl] N-methylcarbamothioate is sourced from PubChem (CID 12037792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).