C25H29NO5 — CID 12038074
[(3aR,4R)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] (E)-5-[(4-methoxyphenyl)methoxy]pent-2-enoate (PubChem CID 12038074) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is [(3aR,4R)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] (E)-5-[(4-methoxyphenyl)methoxy]pent-2-enoate.
| Compound Name | [(3aR,4R)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] (E)-5-[(4-methoxyphenyl)methoxy]pent-2-enoate |
|---|---|
| PubChem CID | 12038074 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | [(3aR,4R)-2-phenyl-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazol-4-yl] (E)-5-[(4-methoxyphenyl)methoxy]pent-2-enoate |
| SMILES | COc1ccc(COCC/C=C/C(=O)O[C@@H]2CCN3OC(c4ccccc4)C[C@H]23)cc1 |
| InChI | InChI=1S/C25H29NO5/c1-28-21-12-10-19(11-13-21)18-29-16-6-5-9-25(27)30-23-14-15-26-22(23)17-24(31-26)20-7-3-2-4-8-20/h2-5,7-13,22-24H,6,14-18H2,1H3/b9-5+/t22-,23-,24?/m1/s1 |
| InChIKey | LGHMUIIVFRKNDB-GTVBPNOESA-N |
| XLogP | 4.22 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|