C20H20O2 — CID 12038227
(1R,2S,4S,7R)-4,7-bis(4-methylphenyl)-3,8-dioxatricyclo[5.1.0.02,4]octane (PubChem CID 12038227) has the molecular formula C20H20O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is (1R,2S,4S,7R)-4,7-bis(4-methylphenyl)-3,8-dioxatricyclo[5.1.0.02,4]octane.
| Compound Name | (1R,2S,4S,7R)-4,7-bis(4-methylphenyl)-3,8-dioxatricyclo[5.1.0.02,4]octane |
|---|---|
| PubChem CID | 12038227 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (1R,2S,4S,7R)-4,7-bis(4-methylphenyl)-3,8-dioxatricyclo[5.1.0.02,4]octane |
| SMILES | Cc1ccc([C@@]23CC[C@]4(c5ccc(C)cc5)O[C@@H]4[C@@H]2O3)cc1 |
| InChI | InChI=1S/C20H20O2/c1-13-3-7-15(8-4-13)19-11-12-20(18(22-20)17(19)21-19)16-9-5-14(2)6-10-16/h3-10,17-18H,11-12H2,1-2H3/t17-,18+,19-,20+ |
| InChIKey | DWEQWQLJJHRUAD-FGYAAKKASA-N |
| XLogP | 3.99 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|