C12H12F9NO3S — CID 12038243
(8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 12038243) has the molecular formula C12H12F9NO3S and a molecular weight of 421.28 g/mol. Its IUPAC name is (8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 12038243 |
| Molecular Formula | C12H12F9NO3S |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | (8-methyl-8-azabicyclo[3.2.1]oct-2-en-3-yl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CN1C2C=C(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1CC2 |
| InChI | InChI=1S/C12H12F9NO3S/c1-22-6-2-3-7(22)5-8(4-6)25-26(23,24)12(20,21)10(15,16)9(13,14)11(17,18)19/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | DFBQQODXGKKRMZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|