C17H24F2O — CID 12038416
(E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol (PubChem CID 12038416) has the molecular formula C17H24F2O and a molecular weight of 282.37 g/mol. Its IUPAC name is (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol.
| Compound Name | (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol |
|---|---|
| PubChem CID | 12038416 |
| Molecular Formula | C17H24F2O |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol |
| SMILES | CCCCC(F)(F)/C(C)=C/C(O)CCc1ccccc1 |
| InChI | InChI=1S/C17H24F2O/c1-3-4-12-17(18,19)14(2)13-16(20)11-10-15-8-6-5-7-9-15/h5-9,13,16,20H,3-4,10-12H2,1-2H3/b14-13+ |
| InChIKey | BWTGDKPTEUMOQA-BUHFOSPRSA-N |
| XLogP | 4.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|