About (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol
(E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol (PubChem CID 12038416) has the molecular formula C17H24F2O
and a molecular weight of 282.37 g/mol. Its IUPAC name is (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol.
Molecular Properties
| Compound Name | (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol |
| PubChem CID | 12038416 |
| Molecular Formula | C17H24F2O |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol |
| SMILES | CCCCC(F)(F)/C(C)=C/C(O)CCc1ccccc1 |
| InChI | InChI=1S/C17H24F2O/c1-3-4-12-17(18,19)14(2)13-16(20)11-10-15-8-6-5-7-9-15/h5-9,13,16,20H,3-4,10-12H2,1-2H3/b14-13+ |
| InChIKey | BWTGDKPTEUMOQA-BUHFOSPRSA-N |
| XLogP | 4.75 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol?
The IUPAC name of (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol (CID 12038416) is (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol.
What is the SMILES notation for (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol?
The canonical SMILES for (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol is CCCCC(F)(F)/C(C)=C/C(O)CCc1ccccc1.
What is the InChIKey of (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol?
The InChIKey is BWTGDKPTEUMOQA-BUHFOSPRSA-N. The full InChI is InChI=1S/C17H24F2O/c1-3-4-12-17(18,19)14(2)13-16(20)11-10-15-8-6-5-7-9-15/h5-9,13,16,20H,3-4,10-12H2,1-2H3/b14-13+.
What are the key properties of (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol?
(E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol has a molecular weight of 282.37 g/mol, XLogP of 4.75, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6,6-difluoro-5-methyl-1-phenyldec-4-en-3-ol is sourced from PubChem (CID 12038416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).